C13H14ClN3O4S — CID 121160129
3-[1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 121160129) has the molecular formula C13H14ClN3O4S and a molecular weight of 343.79 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121160129 |
| Molecular Formula | C13H14ClN3O4S |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 3-[1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1C1CCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C13H14ClN3O4S/c14-9-1-3-11(4-2-9)22(20,21)16-6-5-10(8-16)17-12(18)7-15-13(17)19/h1-4,10H,5-8H2,(H,15,19) |
| InChIKey | UXLVBOPTVOGDTF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|