C20H21N3O4S — CID 121160139
3-[1-[4-(4-methylphenyl)phenyl]sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 121160139) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-[1-[4-(4-methylphenyl)phenyl]sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-[4-(4-methylphenyl)phenyl]sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121160139 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-[1-[4-(4-methylphenyl)phenyl]sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2ccc(S(=O)(=O)N3CCC(N4C(=O)CNC4=O)C3)cc2)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-14-2-4-15(5-3-14)16-6-8-18(9-7-16)28(26,27)22-11-10-17(13-22)23-19(24)12-21-20(23)25/h2-9,17H,10-13H2,1H3,(H,21,25) |
| InChIKey | RAOUMPPIMRDZGB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|