C19H19N3O4S — CID 121160153
3-[1-(3-phenylphenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 121160153) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is 3-[1-(3-phenylphenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(3-phenylphenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121160153 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3-[1-(3-phenylphenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1C1CCN(S(=O)(=O)c2cccc(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C19H19N3O4S/c23-18-12-20-19(24)22(18)16-9-10-21(13-16)27(25,26)17-8-4-7-15(11-17)14-5-2-1-3-6-14/h1-8,11,16H,9-10,12-13H2,(H,20,24) |
| InChIKey | OHEPYQNHFDLJEY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|