C17H23N3O4S — CID 121160104
3-[1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 121160104) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 3-[1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121160104 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-[1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCC(N3C(=O)CNC3=O)C2)c1C |
| InChI | InChI=1S/C17H23N3O4S/c1-10-7-11(2)13(4)16(12(10)3)25(23,24)19-6-5-14(9-19)20-15(21)8-18-17(20)22/h7,14H,5-6,8-9H2,1-4H3,(H,18,22) |
| InChIKey | WHYSXAALCDCNTR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|