C17H22N4O5S — CID 121160161
N-[4-[3-(2,5-dioxoimidazolidin-1-yl)pyrrolidin-1-yl]sulfonyl-3-methylphenyl]propanamide (PubChem CID 121160161) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is N-[4-[3-(2,5-dioxoimidazolidin-1-yl)pyrrolidin-1-yl]sulfonyl-3-methylphenyl]propanamide.
| Compound Name | N-[4-[3-(2,5-dioxoimidazolidin-1-yl)pyrrolidin-1-yl]sulfonyl-3-methylphenyl]propanamide |
|---|---|
| PubChem CID | 121160161 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[4-[3-(2,5-dioxoimidazolidin-1-yl)pyrrolidin-1-yl]sulfonyl-3-methylphenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(S(=O)(=O)N2CCC(N3C(=O)CNC3=O)C2)c(C)c1 |
| InChI | InChI=1S/C17H22N4O5S/c1-3-15(22)19-12-4-5-14(11(2)8-12)27(25,26)20-7-6-13(10-20)21-16(23)9-18-17(21)24/h4-5,8,13H,3,6-7,9-10H2,1-2H3,(H,18,24)(H,19,22) |
| InChIKey | CVJYPTKLPLYYSU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|