C19H17Cl2N3O4S — CID 121160142
3-[1-[4-(3,4-dichlorophenyl)phenyl]sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 121160142) has the molecular formula C19H17Cl2N3O4S and a molecular weight of 454.34 g/mol. Its IUPAC name is 3-[1-[4-(3,4-dichlorophenyl)phenyl]sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-[4-(3,4-dichlorophenyl)phenyl]sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121160142 |
| Molecular Formula | C19H17Cl2N3O4S |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 3-[1-[4-(3,4-dichlorophenyl)phenyl]sulfonylpyrrolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1C1CCN(S(=O)(=O)c2ccc(-c3ccc(Cl)c(Cl)c3)cc2)C1 |
| InChI | InChI=1S/C19H17Cl2N3O4S/c20-16-6-3-13(9-17(16)21)12-1-4-15(5-2-12)29(27,28)23-8-7-14(11-23)24-18(25)10-22-19(24)26/h1-6,9,14H,7-8,10-11H2,(H,22,26) |
| InChIKey | ONICVSXPFCCXNH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|