C14H18N4O6S2 — CID 121160578
4-[4-(2,5-dioxoimidazolidin-1-yl)piperidin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 121160578) has the molecular formula C14H18N4O6S2 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-[4-(2,5-dioxoimidazolidin-1-yl)piperidin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | 4-[4-(2,5-dioxoimidazolidin-1-yl)piperidin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 121160578 |
| Molecular Formula | C14H18N4O6S2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 4-[4-(2,5-dioxoimidazolidin-1-yl)piperidin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCC(N3C(=O)CNC3=O)CC2)cc1 |
| InChI | InChI=1S/C14H18N4O6S2/c15-25(21,22)11-1-3-12(4-2-11)26(23,24)17-7-5-10(6-8-17)18-13(19)9-16-14(18)20/h1-4,10H,5-9H2,(H,16,20)(H2,15,21,22) |
| InChIKey | JDDBQDCOGCYRTL-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|