C12H12ClN3O4S — CID 121159644
3-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]imidazolidine-2,4-dione (PubChem CID 121159644) has the molecular formula C12H12ClN3O4S and a molecular weight of 329.77 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121159644 |
| Molecular Formula | C12H12ClN3O4S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 3-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1C1CN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C12H12ClN3O4S/c13-8-1-3-10(4-2-8)21(19,20)15-6-9(7-15)16-11(17)5-14-12(16)18/h1-4,9H,5-7H2,(H,14,18) |
| InChIKey | ZZQYIZGBWYUOOF-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|