C16H21N3O5S — CID 121160525
3-[1-(2-ethoxyphenyl)sulfonylpiperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 121160525) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 3-[1-(2-ethoxyphenyl)sulfonylpiperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(2-ethoxyphenyl)sulfonylpiperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121160525 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-[1-(2-ethoxyphenyl)sulfonylpiperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CCOc1ccccc1S(=O)(=O)N1CCC(N2C(=O)CNC2=O)CC1 |
| InChI | InChI=1S/C16H21N3O5S/c1-2-24-13-5-3-4-6-14(13)25(22,23)18-9-7-12(8-10-18)19-15(20)11-17-16(19)21/h3-6,12H,2,7-11H2,1H3,(H,17,21) |
| InChIKey | OGLWLBCMBXWKNL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|