C13H16BrF2NO3S — CID 82687785
4-(2-bromoethoxy)-1-(2,5-difluorophenyl)sulfonylpiperidine (PubChem CID 82687785) has the molecular formula C13H16BrF2NO3S and a molecular weight of 384.24 g/mol. Its IUPAC name is 4-(2-bromoethoxy)-1-(2,5-difluorophenyl)sulfonylpiperidine.
| Compound Name | 4-(2-bromoethoxy)-1-(2,5-difluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 82687785 |
| Molecular Formula | C13H16BrF2NO3S |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 4-(2-bromoethoxy)-1-(2,5-difluorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1cc(F)ccc1F)N1CCC(OCCBr)CC1 |
| InChI | InChI=1S/C13H16BrF2NO3S/c14-5-8-20-11-3-6-17(7-4-11)21(18,19)13-9-10(15)1-2-12(13)16/h1-2,9,11H,3-8H2 |
| InChIKey | ZZTCBDUQBXKXGD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|