C13H16BrF2NO2S — CID 80671795
2-(2-bromoethyl)-1-(2,5-difluorophenyl)sulfonylpiperidine (PubChem CID 80671795) has the molecular formula C13H16BrF2NO2S and a molecular weight of 368.24 g/mol. Its IUPAC name is 2-(2-bromoethyl)-1-(2,5-difluorophenyl)sulfonylpiperidine.
| Compound Name | 2-(2-bromoethyl)-1-(2,5-difluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 80671795 |
| Molecular Formula | C13H16BrF2NO2S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 2-(2-bromoethyl)-1-(2,5-difluorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1cc(F)ccc1F)N1CCCCC1CCBr |
| InChI | InChI=1S/C13H16BrF2NO2S/c14-7-6-11-3-1-2-8-17(11)20(18,19)13-9-10(15)4-5-12(13)16/h4-5,9,11H,1-3,6-8H2 |
| InChIKey | ARFDIPNACWIMMQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|