C13H14F2N4O2S — CID 126852616
2-[[1-(2,5-difluorophenyl)sulfonylpyrrolidin-2-yl]methyl]triazole (PubChem CID 126852616) has the molecular formula C13H14F2N4O2S and a molecular weight of 328.34 g/mol. Its IUPAC name is 2-[[1-(2,5-difluorophenyl)sulfonylpyrrolidin-2-yl]methyl]triazole.
| Compound Name | 2-[[1-(2,5-difluorophenyl)sulfonylpyrrolidin-2-yl]methyl]triazole |
|---|---|
| PubChem CID | 126852616 |
| Molecular Formula | C13H14F2N4O2S |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-[[1-(2,5-difluorophenyl)sulfonylpyrrolidin-2-yl]methyl]triazole |
| SMILES | O=S(=O)(c1cc(F)ccc1F)N1CCCC1Cn1nccn1 |
| InChI | InChI=1S/C13H14F2N4O2S/c14-10-3-4-12(15)13(8-10)22(20,21)18-7-1-2-11(18)9-19-16-5-6-17-19/h3-6,8,11H,1-2,7,9H2 |
| InChIKey | NACZCNIPSSVLDV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |