C14H18F2N2O5S2 — CID 90592825
2-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]sulfonyl-N-methylacetamide (PubChem CID 90592825) has the molecular formula C14H18F2N2O5S2 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]sulfonyl-N-methylacetamide.
| Compound Name | 2-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]sulfonyl-N-methylacetamide |
|---|---|
| PubChem CID | 90592825 |
| Molecular Formula | C14H18F2N2O5S2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]sulfonyl-N-methylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C14H18F2N2O5S2/c1-17-14(19)9-24(20,21)11-4-6-18(7-5-11)25(22,23)13-8-10(15)2-3-12(13)16/h2-3,8,11H,4-7,9H2,1H3,(H,17,19) |
| InChIKey | FQRCTQVHKVLIQI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |