C15H21FN2O6S2 — CID 90592837
2-[1-(5-fluoro-2-methoxyphenyl)sulfonylpiperidin-4-yl]sulfonyl-N-methylacetamide (PubChem CID 90592837) has the molecular formula C15H21FN2O6S2 and a molecular weight of 408.47 g/mol. Its IUPAC name is 2-[1-(5-fluoro-2-methoxyphenyl)sulfonylpiperidin-4-yl]sulfonyl-N-methylacetamide.
| Compound Name | 2-[1-(5-fluoro-2-methoxyphenyl)sulfonylpiperidin-4-yl]sulfonyl-N-methylacetamide |
|---|---|
| PubChem CID | 90592837 |
| Molecular Formula | C15H21FN2O6S2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-[1-(5-fluoro-2-methoxyphenyl)sulfonylpiperidin-4-yl]sulfonyl-N-methylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C1CCN(S(=O)(=O)c2cc(F)ccc2OC)CC1 |
| InChI | InChI=1S/C15H21FN2O6S2/c1-17-15(19)10-25(20,21)12-5-7-18(8-6-12)26(22,23)14-9-11(16)3-4-13(14)24-2/h3-4,9,12H,5-8,10H2,1-2H3,(H,17,19) |
| InChIKey | NFEZUXLFBUDYPS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |