C17H24N2O6S — CID 90592548
2-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]sulfonyl-N-methylacetamide (PubChem CID 90592548) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is 2-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]sulfonyl-N-methylacetamide.
| Compound Name | 2-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]sulfonyl-N-methylacetamide |
|---|---|
| PubChem CID | 90592548 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]sulfonyl-N-methylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C1CCN(C(=O)c2c(OC)cccc2OC)CC1 |
| InChI | InChI=1S/C17H24N2O6S/c1-18-15(20)11-26(22,23)12-7-9-19(10-8-12)17(21)16-13(24-2)5-4-6-14(16)25-3/h4-6,12H,7-11H2,1-3H3,(H,18,20) |
| InChIKey | FQAKWIQJCBLPAT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |