C15H19IN2O4S — CID 90592768
2-[1-(3-iodobenzoyl)piperidin-4-yl]sulfonyl-N-methylacetamide (PubChem CID 90592768) has the molecular formula C15H19IN2O4S and a molecular weight of 450.30 g/mol. Its IUPAC name is 2-[1-(3-iodobenzoyl)piperidin-4-yl]sulfonyl-N-methylacetamide.
| Compound Name | 2-[1-(3-iodobenzoyl)piperidin-4-yl]sulfonyl-N-methylacetamide |
|---|---|
| PubChem CID | 90592768 |
| Molecular Formula | C15H19IN2O4S |
| Molecular Weight | 450.30 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | 2-[1-(3-iodobenzoyl)piperidin-4-yl]sulfonyl-N-methylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C1CCN(C(=O)c2cccc(I)c2)CC1 |
| InChI | InChI=1S/C15H19IN2O4S/c1-17-14(19)10-23(21,22)13-5-7-18(8-6-13)15(20)11-3-2-4-12(16)9-11/h2-4,9,13H,5-8,10H2,1H3,(H,17,19) |
| InChIKey | CDKXFTCLNYYPQD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|