C19H27N3O7S2 — CID 90592568
N-methyl-2-[1-(4-morpholin-4-ylsulfonylbenzoyl)piperidin-4-yl]sulfonylacetamide (PubChem CID 90592568) has the molecular formula C19H27N3O7S2 and a molecular weight of 473.57 g/mol. Its IUPAC name is N-methyl-2-[1-(4-morpholin-4-ylsulfonylbenzoyl)piperidin-4-yl]sulfonylacetamide.
| Compound Name | N-methyl-2-[1-(4-morpholin-4-ylsulfonylbenzoyl)piperidin-4-yl]sulfonylacetamide |
|---|---|
| PubChem CID | 90592568 |
| Molecular Formula | C19H27N3O7S2 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-methyl-2-[1-(4-morpholin-4-ylsulfonylbenzoyl)piperidin-4-yl]sulfonylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C1CCN(C(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C19H27N3O7S2/c1-20-18(23)14-30(25,26)16-6-8-21(9-7-16)19(24)15-2-4-17(5-3-15)31(27,28)22-10-12-29-13-11-22/h2-5,16H,6-14H2,1H3,(H,20,23) |
| InChIKey | KGONXAZGSCPIOG-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |