C19H28N2O5S — CID 110602769
[3-(ethoxymethyl)piperidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 110602769) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is [3-(ethoxymethyl)piperidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | [3-(ethoxymethyl)piperidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 110602769 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [3-(ethoxymethyl)piperidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | CCOCC1CCCN(C(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)C1 |
| InChI | InChI=1S/C19H28N2O5S/c1-2-25-15-16-4-3-9-20(14-16)19(22)17-5-7-18(8-6-17)27(23,24)21-10-12-26-13-11-21/h5-8,16H,2-4,9-15H2,1H3 |
| InChIKey | GKHRNJKTHAYWNH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |