C21H24N2O7S2 — CID 90593367
[3-(4-methoxyphenyl)sulfonylazetidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 90593367) has the molecular formula C21H24N2O7S2 and a molecular weight of 480.56 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)sulfonylazetidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | [3-(4-methoxyphenyl)sulfonylazetidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 90593367 |
| Molecular Formula | C21H24N2O7S2 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | [3-(4-methoxyphenyl)sulfonylazetidin-1-yl]-(4-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | COc1ccc(S(=O)(=O)C2CN(C(=O)c3ccc(S(=O)(=O)N4CCOCC4)cc3)C2)cc1 |
| InChI | InChI=1S/C21H24N2O7S2/c1-29-17-4-8-18(9-5-17)31(25,26)20-14-22(15-20)21(24)16-2-6-19(7-3-16)32(27,28)23-10-12-30-13-11-23/h2-9,20H,10-15H2,1H3 |
| InChIKey | TXCFJSGGENYQSR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |