C16H17F2N3O2S — CID 17461113
1-(2,5-difluorophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine (PubChem CID 17461113) has the molecular formula C16H17F2N3O2S and a molecular weight of 353.39 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine.
| Compound Name | 1-(2,5-difluorophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine |
|---|---|
| PubChem CID | 17461113 |
| Molecular Formula | C16H17F2N3O2S |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine |
| SMILES | O=S(=O)(c1cc(F)ccc1F)N1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C16H17F2N3O2S/c17-14-1-2-15(18)16(11-14)24(22,23)21-9-7-20(8-10-21)12-13-3-5-19-6-4-13/h1-6,11H,7-10,12H2 |
| InChIKey | AFNNPLJJXCZXMO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |