C18H17F2N3O2S — CID 8797199
2-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile (PubChem CID 8797199) has the molecular formula C18H17F2N3O2S and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 8797199 |
| Molecular Formula | C18H17F2N3O2S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C18H17F2N3O2S/c19-16-5-6-17(20)18(11-16)26(24,25)23-9-7-22(8-10-23)13-15-4-2-1-3-14(15)12-21/h1-6,11H,7-10,13H2 |
| InChIKey | QYWQSVBFTNDSKF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |