C19H21N3O2S — CID 8691959
2-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile (PubChem CID 8691959) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 8691959 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(Cc3ccccc3C#N)CC2)cc1 |
| InChI | InChI=1S/C19H21N3O2S/c1-16-6-8-19(9-7-16)25(23,24)22-12-10-21(11-13-22)15-18-5-3-2-4-17(18)14-20/h2-9H,10-13,15H2,1H3 |
| InChIKey | IIPWVBAPMZTNFM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |