C19H22F2N2O2S — CID 8796966
1-(2,5-difluorophenyl)sulfonyl-4-[(2,5-dimethylphenyl)methyl]piperazine (PubChem CID 8796966) has the molecular formula C19H22F2N2O2S and a molecular weight of 380.46 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfonyl-4-[(2,5-dimethylphenyl)methyl]piperazine.
| Compound Name | 1-(2,5-difluorophenyl)sulfonyl-4-[(2,5-dimethylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 8796966 |
| Molecular Formula | C19H22F2N2O2S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfonyl-4-[(2,5-dimethylphenyl)methyl]piperazine |
| SMILES | Cc1ccc(C)c(CN2CCN(S(=O)(=O)c3cc(F)ccc3F)CC2)c1 |
| InChI | InChI=1S/C19H22F2N2O2S/c1-14-3-4-15(2)16(11-14)13-22-7-9-23(10-8-22)26(24,25)19-12-17(20)5-6-18(19)21/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | RXANMUJSWLBBFV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |