C18H24N4O5S — CID 163337174
(1R,9S)-12-(3,4-dimethoxyphenyl)sulfonyl-4-(methoxymethyl)-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene (PubChem CID 163337174) has the molecular formula C18H24N4O5S and a molecular weight of 408.48 g/mol. Its IUPAC name is (1R,9S)-12-(3,4-dimethoxyphenyl)sulfonyl-4-(methoxymethyl)-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene.
| Compound Name | (1R,9S)-12-(3,4-dimethoxyphenyl)sulfonyl-4-(methoxymethyl)-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene |
|---|---|
| PubChem CID | 163337174 |
| Molecular Formula | C18H24N4O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (1R,9S)-12-(3,4-dimethoxyphenyl)sulfonyl-4-(methoxymethyl)-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene |
| SMILES | COCc1nnc2n1C[C@H]1CC[C@@H](C2)N1S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H24N4O5S/c1-25-11-18-20-19-17-8-12-4-5-13(10-21(17)18)22(12)28(23,24)14-6-7-15(26-2)16(9-14)27-3/h6-7,9,12-13H,4-5,8,10-11H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | MEXIDLJJMAMPDK-QWHCGFSZSA-N |
| XLogP | 1.22 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |