C22H30N2O8S2 — CID 23654829
(2R,5S)-1,4-bis[(3,4-dimethoxyphenyl)sulfonyl]-2,5-dimethylpiperazine (PubChem CID 23654829) has the molecular formula C22H30N2O8S2 and a molecular weight of 514.62 g/mol. Its IUPAC name is (2R,5S)-1,4-bis[(3,4-dimethoxyphenyl)sulfonyl]-2,5-dimethylpiperazine.
| Compound Name | (2R,5S)-1,4-bis[(3,4-dimethoxyphenyl)sulfonyl]-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 23654829 |
| Molecular Formula | C22H30N2O8S2 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | (2R,5S)-1,4-bis[(3,4-dimethoxyphenyl)sulfonyl]-2,5-dimethylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@H](C)N(S(=O)(=O)c3ccc(OC)c(OC)c3)C[C@H]2C)cc1OC |
| InChI | InChI=1S/C22H30N2O8S2/c1-15-13-24(34(27,28)18-8-10-20(30-4)22(12-18)32-6)16(2)14-23(15)33(25,26)17-7-9-19(29-3)21(11-17)31-5/h7-12,15-16H,13-14H2,1-6H3/t15-,16+ |
| InChIKey | DQUYYZAKCCYFEL-IYBDPMFKSA-N |
| XLogP | 2.19 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |