C27H40N2O6S2 — CID 98161840
(2R)-1,4-bis[(3-tert-butyl-4-methoxyphenyl)sulfonyl]-2-methylpiperazine (PubChem CID 98161840) has the molecular formula C27H40N2O6S2 and a molecular weight of 552.76 g/mol. Its IUPAC name is (2R)-1,4-bis[(3-tert-butyl-4-methoxyphenyl)sulfonyl]-2-methylpiperazine.
| Compound Name | (2R)-1,4-bis[(3-tert-butyl-4-methoxyphenyl)sulfonyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 98161840 |
| Molecular Formula | C27H40N2O6S2 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | (2R)-1,4-bis[(3-tert-butyl-4-methoxyphenyl)sulfonyl]-2-methylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(OC)c(C(C)(C)C)c3)[C@H](C)C2)cc1C(C)(C)C |
| InChI | InChI=1S/C27H40N2O6S2/c1-19-18-28(36(30,31)20-10-12-24(34-8)22(16-20)26(2,3)4)14-15-29(19)37(32,33)21-11-13-25(35-9)23(17-21)27(5,6)7/h10-13,16-17,19H,14-15,18H2,1-9H3/t19-/m1/s1 |
| InChIKey | JQWNHJJKMIAKOM-LJQANCHMSA-N |
| XLogP | 4.38 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |