C17H26N2O5S — CID 110818549
methyl 4-(3-tert-butyl-4-methoxyphenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 110818549) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is methyl 4-(3-tert-butyl-4-methoxyphenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | methyl 4-(3-tert-butyl-4-methoxyphenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 110818549 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | methyl 4-(3-tert-butyl-4-methoxyphenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(S(=O)(=O)c2ccc(OC)c(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C17H26N2O5S/c1-17(2,3)14-12-13(6-7-15(14)23-4)25(21,22)19-10-8-18(9-11-19)16(20)24-5/h6-7,12H,8-11H2,1-5H3 |
| InChIKey | QBVHUYQLAIDLAX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |