C14H17N2O7S- — CID 2051856
2-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoacetate (PubChem CID 2051856) has the molecular formula C14H17N2O7S- and a molecular weight of 357.36 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoacetate.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 2051856 |
| Molecular Formula | C14H17N2O7S- |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoacetate |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)C(=O)[O-])CC2)cc1OC |
| InChI | InChI=1S/C14H18N2O7S/c1-22-11-4-3-10(9-12(11)23-2)24(20,21)16-7-5-15(6-8-16)13(17)14(18)19/h3-4,9H,5-8H2,1-2H3,(H,18,19)/p-1 |
| InChIKey | BHDIHGXWPGZYIJ-UHFFFAOYSA-M |
| XLogP | -1.71 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|