C15H19N2O7S- — CID 2051858
3-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-oxopropanoate (PubChem CID 2051858) has the molecular formula C15H19N2O7S- and a molecular weight of 371.39 g/mol. Its IUPAC name is 3-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-oxopropanoate.
| Compound Name | 3-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 2051858 |
| Molecular Formula | C15H19N2O7S- |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 3-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-oxopropanoate |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)CC(=O)[O-])CC2)cc1OC |
| InChI | InChI=1S/C15H20N2O7S/c1-23-12-4-3-11(9-13(12)24-2)25(21,22)17-7-5-16(6-8-17)14(18)10-15(19)20/h3-4,9H,5-8,10H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | LFAGZMWMJAWCTA-UHFFFAOYSA-M |
| XLogP | -1.32 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|