C15H21N3O6S — CID 110818596
methyl 4-(3-acetamido-4-methoxyphenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 110818596) has the molecular formula C15H21N3O6S and a molecular weight of 371.42 g/mol. Its IUPAC name is methyl 4-(3-acetamido-4-methoxyphenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | methyl 4-(3-acetamido-4-methoxyphenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 110818596 |
| Molecular Formula | C15H21N3O6S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | methyl 4-(3-acetamido-4-methoxyphenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(S(=O)(=O)c2ccc(OC)c(NC(C)=O)c2)CC1 |
| InChI | InChI=1S/C15H21N3O6S/c1-11(19)16-13-10-12(4-5-14(13)23-2)25(21,22)18-8-6-17(7-9-18)15(20)24-3/h4-5,10H,6-9H2,1-3H3,(H,16,19) |
| InChIKey | JCGGBCIWDKWFFO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |