C21H26Cl2N2O8S2 — CID 44787244
1,4-bis[(4-chloro-2,5-dimethoxyphenyl)sulfonyl]-2-methylpiperazine (PubChem CID 44787244) has the molecular formula C21H26Cl2N2O8S2 and a molecular weight of 569.49 g/mol. Its IUPAC name is 1,4-bis[(4-chloro-2,5-dimethoxyphenyl)sulfonyl]-2-methylpiperazine.
| Compound Name | 1,4-bis[(4-chloro-2,5-dimethoxyphenyl)sulfonyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 44787244 |
| Molecular Formula | C21H26Cl2N2O8S2 |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | 1,4-bis[(4-chloro-2,5-dimethoxyphenyl)sulfonyl]-2-methylpiperazine |
| SMILES | COc1cc(S(=O)(=O)N2CCN(S(=O)(=O)c3cc(OC)c(Cl)cc3OC)C(C)C2)c(OC)cc1Cl |
| InChI | InChI=1S/C21H26Cl2N2O8S2/c1-13-12-24(34(26,27)20-10-16(30-2)14(22)8-18(20)32-4)6-7-25(13)35(28,29)21-11-17(31-3)15(23)9-19(21)33-5/h8-11,13H,6-7,12H2,1-5H3 |
| InChIKey | IOXSRAIVZRIJBF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |