C17H14Cl6N2O4S2 — CID 98212086
(2R)-2-methyl-1,4-bis[(2,4,5-trichlorophenyl)sulfonyl]piperazine (PubChem CID 98212086) has the molecular formula C17H14Cl6N2O4S2 and a molecular weight of 587.16 g/mol. Its IUPAC name is (2R)-2-methyl-1,4-bis[(2,4,5-trichlorophenyl)sulfonyl]piperazine.
| Compound Name | (2R)-2-methyl-1,4-bis[(2,4,5-trichlorophenyl)sulfonyl]piperazine |
|---|---|
| PubChem CID | 98212086 |
| Molecular Formula | C17H14Cl6N2O4S2 |
| Molecular Weight | 587.16 g/mol |
| Exact Mass | 583.85 |
| IUPAC Name | (2R)-2-methyl-1,4-bis[(2,4,5-trichlorophenyl)sulfonyl]piperazine |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)CCN1S(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl6N2O4S2/c1-9-8-24(30(26,27)16-6-12(20)10(18)4-14(16)22)2-3-25(9)31(28,29)17-7-13(21)11(19)5-15(17)23/h4-7,9H,2-3,8H2,1H3/t9-/m1/s1 |
| InChIKey | UHFMTBFSCXVBSX-SECBINFHSA-N |
| XLogP | 5.69 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.16 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|