C19H20Cl4N2O6S2 — CID 98212078
(2R)-1,4-bis[(3,4-dichloro-2-methoxyphenyl)sulfonyl]-2-methylpiperazine (PubChem CID 98212078) has the molecular formula C19H20Cl4N2O6S2 and a molecular weight of 578.32 g/mol. Its IUPAC name is (2R)-1,4-bis[(3,4-dichloro-2-methoxyphenyl)sulfonyl]-2-methylpiperazine.
| Compound Name | (2R)-1,4-bis[(3,4-dichloro-2-methoxyphenyl)sulfonyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 98212078 |
| Molecular Formula | C19H20Cl4N2O6S2 |
| Molecular Weight | 578.32 g/mol |
| Exact Mass | 575.95 |
| IUPAC Name | (2R)-1,4-bis[(3,4-dichloro-2-methoxyphenyl)sulfonyl]-2-methylpiperazine |
| SMILES | COc1c(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(Cl)c(Cl)c3OC)[C@H](C)C2)ccc(Cl)c1Cl |
| InChI | InChI=1S/C19H20Cl4N2O6S2/c1-11-10-24(32(26,27)14-6-4-12(20)16(22)18(14)30-2)8-9-25(11)33(28,29)15-7-5-13(21)17(23)19(15)31-3/h4-7,11H,8-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | NGRMBPISSNOVAG-LLVKDONJSA-N |
| XLogP | 4.40 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |