C13H17Cl2NO3S — CID 802910
(2R)-1-(3,4-dichloro-2-methoxyphenyl)sulfonyl-2-methylpiperidine (PubChem CID 802910) has the molecular formula C13H17Cl2NO3S and a molecular weight of 338.26 g/mol. Its IUPAC name is (2R)-1-(3,4-dichloro-2-methoxyphenyl)sulfonyl-2-methylpiperidine.
| Compound Name | (2R)-1-(3,4-dichloro-2-methoxyphenyl)sulfonyl-2-methylpiperidine |
|---|---|
| PubChem CID | 802910 |
| Molecular Formula | C13H17Cl2NO3S |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | (2R)-1-(3,4-dichloro-2-methoxyphenyl)sulfonyl-2-methylpiperidine |
| SMILES | COc1c(S(=O)(=O)N2CCCC[C@H]2C)ccc(Cl)c1Cl |
| InChI | InChI=1S/C13H17Cl2NO3S/c1-9-5-3-4-8-16(9)20(17,18)11-7-6-10(14)12(15)13(11)19-2/h6-7,9H,3-5,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | BMENQJYPSULLHQ-SECBINFHSA-N |
| XLogP | 3.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |