C13H17Cl2NO4S — CID 50876448
4-(3,4-dichloro-2-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 50876448) has the molecular formula C13H17Cl2NO4S and a molecular weight of 354.26 g/mol. Its IUPAC name is 4-(3,4-dichloro-2-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | 4-(3,4-dichloro-2-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 50876448 |
| Molecular Formula | C13H17Cl2NO4S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 4-(3,4-dichloro-2-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | COc1c(S(=O)(=O)N2CC(C)OC(C)C2)ccc(Cl)c1Cl |
| InChI | InChI=1S/C13H17Cl2NO4S/c1-8-6-16(7-9(2)20-8)21(17,18)11-5-4-10(14)12(15)13(11)19-3/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | PEDGVPYLTPUEGF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |