C14H19Cl2NO3S — CID 25248844
1-(3,4-dichloro-2-methoxyphenyl)sulfonyl-3,5-dimethylpiperidine (PubChem CID 25248844) has the molecular formula C14H19Cl2NO3S and a molecular weight of 352.28 g/mol. Its IUPAC name is 1-(3,4-dichloro-2-methoxyphenyl)sulfonyl-3,5-dimethylpiperidine.
| Compound Name | 1-(3,4-dichloro-2-methoxyphenyl)sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 25248844 |
| Molecular Formula | C14H19Cl2NO3S |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-(3,4-dichloro-2-methoxyphenyl)sulfonyl-3,5-dimethylpiperidine |
| SMILES | COc1c(S(=O)(=O)N2CC(C)CC(C)C2)ccc(Cl)c1Cl |
| InChI | InChI=1S/C14H19Cl2NO3S/c1-9-6-10(2)8-17(7-9)21(18,19)12-5-4-11(15)13(16)14(12)20-3/h4-5,9-10H,6-8H2,1-3H3 |
| InChIKey | WXDBBAQIURVLTJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |