C10H13Cl2NO2S2 — CID 3758298
1-(2,5-dichlorothiophen-3-yl)sulfonyl-2-methylpiperidine (PubChem CID 3758298) has the molecular formula C10H13Cl2NO2S2 and a molecular weight of 314.26 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)sulfonyl-2-methylpiperidine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)sulfonyl-2-methylpiperidine |
|---|---|
| PubChem CID | 3758298 |
| Molecular Formula | C10H13Cl2NO2S2 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)sulfonyl-2-methylpiperidine |
| SMILES | CC1CCCCN1S(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H13Cl2NO2S2/c1-7-4-2-3-5-13(7)17(14,15)8-6-9(11)16-10(8)12/h6-7H,2-5H2,1H3 |
| InChIKey | CHFYWQKGTKKPLC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |