C19H22Cl2N2O4S2 — CID 15992527
1,4-bis[(4-chloro-3-methylphenyl)sulfonyl]-2-methylpiperazine (PubChem CID 15992527) has the molecular formula C19H22Cl2N2O4S2 and a molecular weight of 477.44 g/mol. Its IUPAC name is 1,4-bis[(4-chloro-3-methylphenyl)sulfonyl]-2-methylpiperazine.
| Compound Name | 1,4-bis[(4-chloro-3-methylphenyl)sulfonyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 15992527 |
| Molecular Formula | C19H22Cl2N2O4S2 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 1,4-bis[(4-chloro-3-methylphenyl)sulfonyl]-2-methylpiperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(Cl)c(C)c3)C(C)C2)ccc1Cl |
| InChI | InChI=1S/C19H22Cl2N2O4S2/c1-13-10-16(4-6-18(13)20)28(24,25)22-8-9-23(15(3)12-22)29(26,27)17-5-7-19(21)14(2)11-17/h4-7,10-11,15H,8-9,12H2,1-3H3 |
| InChIKey | XKEGDBWYSTVGLV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |