C17H18I2N2O4S2 — CID 92905831
(2S)-1,4-bis[(4-iodophenyl)sulfonyl]-2-methylpiperazine (PubChem CID 92905831) has the molecular formula C17H18I2N2O4S2 and a molecular weight of 632.28 g/mol. Its IUPAC name is (2S)-1,4-bis[(4-iodophenyl)sulfonyl]-2-methylpiperazine.
| Compound Name | (2S)-1,4-bis[(4-iodophenyl)sulfonyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 92905831 |
| Molecular Formula | C17H18I2N2O4S2 |
| Molecular Weight | 632.28 g/mol |
| Exact Mass | 631.88 |
| IUPAC Name | (2S)-1,4-bis[(4-iodophenyl)sulfonyl]-2-methylpiperazine |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(I)cc2)CCN1S(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H18I2N2O4S2/c1-13-12-20(26(22,23)16-6-2-14(18)3-7-16)10-11-21(13)27(24,25)17-8-4-15(19)5-9-17/h2-9,13H,10-12H2,1H3/t13-/m0/s1 |
| InChIKey | LRJDLQRVSDKMMU-ZDUSSCGKSA-N |
| XLogP | 2.98 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|