C13H16Cl3N2O2S+ — CID 11922044
(8aR)-2-(2,4,5-trichlorophenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium (PubChem CID 11922044) has the molecular formula C13H16Cl3N2O2S+ and a molecular weight of 370.71 g/mol. Its IUPAC name is (8aR)-2-(2,4,5-trichlorophenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium.
| Compound Name | (8aR)-2-(2,4,5-trichlorophenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium |
|---|---|
| PubChem CID | 11922044 |
| Molecular Formula | C13H16Cl3N2O2S+ |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | (8aR)-2-(2,4,5-trichlorophenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium |
| SMILES | O=S(=O)(c1cc(Cl)c(Cl)cc1Cl)N1CC[NH+]2CCC[C@@H]2C1 |
| InChI | InChI=1S/C13H15Cl3N2O2S/c14-10-6-12(16)13(7-11(10)15)21(19,20)18-5-4-17-3-1-2-9(17)8-18/h6-7,9H,1-5,8H2/p+1/t9-/m1/s1 |
| InChIKey | RAYHZJDAQXPXQL-SECBINFHSA-O |
| XLogP | 1.70 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|