C13H18ClN2O2S+ — CID 11922111
(8aR)-2-(4-chlorophenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium (PubChem CID 11922111) has the molecular formula C13H18ClN2O2S+ and a molecular weight of 301.82 g/mol. Its IUPAC name is (8aR)-2-(4-chlorophenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium.
| Compound Name | (8aR)-2-(4-chlorophenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium |
|---|---|
| PubChem CID | 11922111 |
| Molecular Formula | C13H18ClN2O2S+ |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (8aR)-2-(4-chlorophenyl)sulfonyl-1,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CC[NH+]2CCC[C@@H]2C1 |
| InChI | InChI=1S/C13H17ClN2O2S/c14-11-3-5-13(6-4-11)19(17,18)16-9-8-15-7-1-2-12(15)10-16/h3-6,12H,1-2,7-10H2/p+1/t12-/m1/s1 |
| InChIKey | GGWQYFWIEMNXTJ-GFCCVEGCSA-O |
| XLogP | 0.39 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |