C18H30ClN3O2S+2 — CID 4756116
1-(4-chlorophenyl)sulfonyl-4-(1-propylpiperidin-1-ium-4-yl)piperazin-4-ium (PubChem CID 4756116) has the molecular formula C18H30ClN3O2S+2 and a molecular weight of 387.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-(1-propylpiperidin-1-ium-4-yl)piperazin-4-ium.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-(1-propylpiperidin-1-ium-4-yl)piperazin-4-ium |
|---|---|
| PubChem CID | 4756116 |
| Molecular Formula | C18H30ClN3O2S+2 |
| Molecular Weight | 387.98 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-(1-propylpiperidin-1-ium-4-yl)piperazin-4-ium |
| SMILES | CCC[NH+]1CCC([NH+]2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)CC1 |
| InChI | InChI=1S/C18H28ClN3O2S/c1-2-9-20-10-7-17(8-11-20)21-12-14-22(15-13-21)25(23,24)18-5-3-16(19)4-6-18/h3-6,17H,2,7-15H2,1H3/p+2 |
| InChIKey | MXBXTSWTXIQPJA-UHFFFAOYSA-P |
| XLogP | -0.31 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.98 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |