C17H18ClF2N2O2S+ — CID 5056582
1-(4-chlorophenyl)sulfonyl-4-[(2,6-difluorophenyl)methyl]piperazin-4-ium (PubChem CID 5056582) has the molecular formula C17H18ClF2N2O2S+ and a molecular weight of 387.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-[(2,6-difluorophenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-[(2,6-difluorophenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 5056582 |
| Molecular Formula | C17H18ClF2N2O2S+ |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-[(2,6-difluorophenyl)methyl]piperazin-4-ium |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CC[NH+](Cc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C17H17ClF2N2O2S/c18-13-4-6-14(7-5-13)25(23,24)22-10-8-21(9-11-22)12-15-16(19)2-1-3-17(15)20/h1-7H,8-12H2/p+1 |
| InChIKey | ONQZCURDYUIRHU-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |