C15H22FN2O2S+ — CID 4742647
1-cyclopentyl-4-(4-fluorophenyl)sulfonylpiperazin-1-ium (PubChem CID 4742647) has the molecular formula C15H22FN2O2S+ and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-cyclopentyl-4-(4-fluorophenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-cyclopentyl-4-(4-fluorophenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 4742647 |
| Molecular Formula | C15H22FN2O2S+ |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-cyclopentyl-4-(4-fluorophenyl)sulfonylpiperazin-1-ium |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CC[NH+](C2CCCC2)CC1 |
| InChI | InChI=1S/C15H21FN2O2S/c16-13-5-7-15(8-6-13)21(19,20)18-11-9-17(10-12-18)14-3-1-2-4-14/h5-8,14H,1-4,9-12H2/p+1 |
| InChIKey | ZWEGQMMLRRJMEX-UHFFFAOYSA-O |
| XLogP | 0.66 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |