C21H31FN3O3S+ — CID 8688412
1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethanone (PubChem CID 8688412) has the molecular formula C21H31FN3O3S+ and a molecular weight of 424.56 g/mol. Its IUPAC name is 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethanone.
| Compound Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 8688412 |
| Molecular Formula | C21H31FN3O3S+ |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]ethanone |
| SMILES | O=C(C[NH+]1CCN(S(=O)(=O)c2ccc(F)cc2)CC1)N1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C21H30FN3O3S/c22-18-7-9-19(10-8-18)29(27,28)24-14-12-23(13-15-24)16-21(26)25-11-3-5-17-4-1-2-6-20(17)25/h7-10,17,20H,1-6,11-16H2/p+1/t17-,20+/m0/s1 |
| InChIKey | BWFOXSVBKXAFBR-FXAWDEMLSA-O |
| XLogP | 0.90 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |