C21H30N2O5S — CID 9333015
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone (PubChem CID 9333015) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 9333015 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCOCC2)cc1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C21H30N2O5S/c24-21(23-11-3-5-17-4-1-2-6-20(17)23)16-28-18-7-9-19(10-8-18)29(25,26)22-12-14-27-15-13-22/h7-10,17,20H,1-6,11-16H2/t17-,20-/m1/s1 |
| InChIKey | QEILFDPQJRHLPJ-YLJYHZDGSA-N |
| XLogP | 2.27 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |