C21H30N2O4S — CID 8802995
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-methyl-5-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 8802995) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-methyl-5-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-methyl-5-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 8802995 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-methyl-5-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C21H30N2O4S/c1-16-8-9-18(28(25,26)22-11-13-27-14-12-22)15-19(16)21(24)23-10-4-6-17-5-2-3-7-20(17)23/h8-9,15,17,20H,2-7,10-14H2,1H3/t17-,20-/m1/s1 |
| InChIKey | JKQYWFYXZBMBEO-YLJYHZDGSA-N |
| XLogP | 2.81 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |