C20H30N2O4S — CID 32915727
N,2-dimethyl-N-(4-methylcyclohexyl)-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 32915727) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is N,2-dimethyl-N-(4-methylcyclohexyl)-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N,2-dimethyl-N-(4-methylcyclohexyl)-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 32915727 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N,2-dimethyl-N-(4-methylcyclohexyl)-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)N(C)C1CCC(C)CC1 |
| InChI | InChI=1S/C20H30N2O4S/c1-15-4-7-17(8-5-15)21(3)20(23)19-14-18(9-6-16(19)2)27(24,25)22-10-12-26-13-11-22/h6,9,14-15,17H,4-5,7-8,10-13H2,1-3H3 |
| InChIKey | JCEHUYHZBLMWPS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |