C24H29FN2O4S — CID 55588260
2-fluoro-N-methyl-5-morpholin-4-ylsulfonyl-N-(4-phenylcyclohexyl)benzamide (PubChem CID 55588260) has the molecular formula C24H29FN2O4S and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-fluoro-N-methyl-5-morpholin-4-ylsulfonyl-N-(4-phenylcyclohexyl)benzamide.
| Compound Name | 2-fluoro-N-methyl-5-morpholin-4-ylsulfonyl-N-(4-phenylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 55588260 |
| Molecular Formula | C24H29FN2O4S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 2-fluoro-N-methyl-5-morpholin-4-ylsulfonyl-N-(4-phenylcyclohexyl)benzamide |
| SMILES | CN(C(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F)C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29FN2O4S/c1-26(20-9-7-19(8-10-20)18-5-3-2-4-6-18)24(28)22-17-21(11-12-23(22)25)32(29,30)27-13-15-31-16-14-27/h2-6,11-12,17,19-20H,7-10,13-16H2,1H3 |
| InChIKey | FNYQUOIYHPJIFL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |