C20H30N2O4S — CID 60610211
N-cyclooctyl-N-methyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 60610211) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-cyclooctyl-N-methyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-cyclooctyl-N-methyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 60610211 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-cyclooctyl-N-methyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CN(C(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)C1CCCCCCC1 |
| InChI | InChI=1S/C20H30N2O4S/c1-21(18-9-5-3-2-4-6-10-18)20(23)17-8-7-11-19(16-17)27(24,25)22-12-14-26-15-13-22/h7-8,11,16,18H,2-6,9-10,12-15H2,1H3 |
| InChIKey | HAVPMMUBYDWZSY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |